C19H25FN4O3S — CID 67349054
N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide (PubChem CID 67349054) has the molecular formula C19H25FN4O3S and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide.
| Compound Name | N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 67349054 |
| Molecular Formula | C19H25FN4O3S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide |
| SMILES | CC(=O)N(c1cc([N+](=O)[O-])ccc1F)C1C(C)S/C(=N\C2CCCCC2)N1C |
| InChI | InChI=1S/C19H25FN4O3S/c1-12-18(22(3)19(28-12)21-14-7-5-4-6-8-14)23(13(2)25)17-11-15(24(26)27)9-10-16(17)20/h9-12,14,18H,4-8H2,1-3H3/b21-19- |
| InChIKey | ZMSUELHPEAPWOY-VZCXRCSSSA-N |
| XLogP | 4.17 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|