C17H20ClFN4O3S — CID 25120306
2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide;hydrochloride (PubChem CID 25120306) has the molecular formula C17H20ClFN4O3S and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 25120306 |
| Molecular Formula | C17H20ClFN4O3S |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)-N-(2-fluoro-5-nitrophenyl)acetamide;hydrochloride |
| SMILES | Cl.Cn1c(CC(=O)Nc2cc([N+](=O)[O-])ccc2F)cs/c1=N\C1CCCC1 |
| InChI | InChI=1S/C17H19FN4O3S.ClH/c1-21-13(10-26-17(21)19-11-4-2-3-5-11)9-16(23)20-15-8-12(22(24)25)6-7-14(15)18;/h6-8,10-11H,2-5,9H2,1H3,(H,20,23);1H/b19-17-; |
| InChIKey | CLRSIOCXWUASLG-HGMLFDQWSA-N |
| XLogP | 3.58 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|