C15H13FN4O4S — CID 55394201
N-(2-fluoro-5-nitrophenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 55394201) has the molecular formula C15H13FN4O4S and a molecular weight of 364.36 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 55394201 |
| Molecular Formula | C15H13FN4O4S |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(N2CCCC2=O)n1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C15H13FN4O4S/c16-11-4-3-10(20(23)24)7-12(11)18-13(21)6-9-8-25-15(17-9)19-5-1-2-14(19)22/h3-4,7-8H,1-2,5-6H2,(H,18,21) |
| InChIKey | REBMMSNUMQAUNW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|