C18H15Cl2FN4O3S — CID 22347741
2-[2-(3-chloro-4-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide;hydrochloride (PubChem CID 22347741) has the molecular formula C18H15Cl2FN4O3S and a molecular weight of 457.31 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(3-chloro-4-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 22347741 |
| Molecular Formula | C18H15Cl2FN4O3S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-[2-(3-chloro-4-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide;hydrochloride |
| SMILES | Cl.Cn1c(CC(=O)Nc2ccc([N+](=O)[O-])cc2)cs/c1=N\c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN4O3S.ClH/c1-23-14(9-17(25)21-11-2-5-13(6-3-11)24(26)27)10-28-18(23)22-12-4-7-16(20)15(19)8-12;/h2-8,10H,9H2,1H3,(H,21,25);1H/b22-18-; |
| InChIKey | DEAVFINOZGZMBM-QNCGTCMPSA-N |
| XLogP | 4.62 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|