C19H15F3N4O4S — CID 22347693
2-[3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 22347693) has the molecular formula C19H15F3N4O4S and a molecular weight of 452.41 g/mol. Its IUPAC name is 2-[3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 22347693 |
| Molecular Formula | C19H15F3N4O4S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[3-methyl-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-4-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | Cn1c(CC(=O)Nc2ccc([N+](=O)[O-])cc2)cs/c1=N\c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N4O4S/c1-25-15(10-17(27)23-12-2-6-14(7-3-12)26(28)29)11-31-18(25)24-13-4-8-16(9-5-13)30-19(20,21)22/h2-9,11H,10H2,1H3,(H,23,27)/b24-18- |
| InChIKey | HDSZCSSDZFAOMA-MOHJPFBDSA-N |
| XLogP | 4.31 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|