C19H16ClFN4OS — CID 22347716
N-(4-cyanophenyl)-2-[2-(2-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide;hydrochloride (PubChem CID 22347716) has the molecular formula C19H16ClFN4OS and a molecular weight of 402.88 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[2-(2-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide;hydrochloride.
| Compound Name | N-(4-cyanophenyl)-2-[2-(2-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 22347716 |
| Molecular Formula | C19H16ClFN4OS |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-(4-cyanophenyl)-2-[2-(2-fluorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide;hydrochloride |
| SMILES | Cl.Cn1c(CC(=O)Nc2ccc(C#N)cc2)cs/c1=N\c1ccccc1F |
| InChI | InChI=1S/C19H15FN4OS.ClH/c1-24-15(10-18(25)22-14-8-6-13(11-21)7-9-14)12-26-19(24)23-17-5-3-2-4-16(17)20;/h2-9,12H,10H2,1H3,(H,22,25);1H/b23-19-; |
| InChIKey | UFOQQJGTIXPBGE-PDEWKSAASA-N |
| XLogP | 3.93 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|