C25H20N4O2S — CID 22347669
N-(4-cyanophenyl)-2-[3-methyl-2-(4-phenoxyphenyl)imino-1,3-thiazol-4-yl]acetamide (PubChem CID 22347669) has the molecular formula C25H20N4O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[3-methyl-2-(4-phenoxyphenyl)imino-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(4-cyanophenyl)-2-[3-methyl-2-(4-phenoxyphenyl)imino-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 22347669 |
| Molecular Formula | C25H20N4O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-(4-cyanophenyl)-2-[3-methyl-2-(4-phenoxyphenyl)imino-1,3-thiazol-4-yl]acetamide |
| SMILES | Cn1c(CC(=O)Nc2ccc(C#N)cc2)cs/c1=N\c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N4O2S/c1-29-21(15-24(30)27-19-9-7-18(16-26)8-10-19)17-32-25(29)28-20-11-13-23(14-12-20)31-22-5-3-2-4-6-22/h2-14,17H,15H2,1H3,(H,27,30)/b28-25- |
| InChIKey | OSZMVNFMDVHFRT-FVDSYPCUSA-N |
| XLogP | 5.16 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|