C30H28N4O5 — CID 122192830
2-[3-[5-(4-cyanophenoxy)pentyl]-2,6-dioxopyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 122192830) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[3-[5-(4-cyanophenoxy)pentyl]-2,6-dioxopyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[3-[5-(4-cyanophenoxy)pentyl]-2,6-dioxopyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 122192830 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-[3-[5-(4-cyanophenoxy)pentyl]-2,6-dioxopyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | N#Cc1ccc(OCCCCCn2ccc(=O)n(CC(=O)Nc3ccc(Oc4ccccc4)cc3)c2=O)cc1 |
| InChI | InChI=1S/C30H28N4O5/c31-21-23-9-13-25(14-10-23)38-20-6-2-5-18-33-19-17-29(36)34(30(33)37)22-28(35)32-24-11-15-27(16-12-24)39-26-7-3-1-4-8-26/h1,3-4,7-17,19H,2,5-6,18,20,22H2,(H,32,35) |
| InChIKey | KDBQKNPKBXXOJF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|