C29H29N3O5 — CID 122192827
2-[2,6-dioxo-3-(5-phenoxypentyl)pyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 122192827) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[2,6-dioxo-3-(5-phenoxypentyl)pyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[2,6-dioxo-3-(5-phenoxypentyl)pyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 122192827 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[2,6-dioxo-3-(5-phenoxypentyl)pyrimidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(Cn1c(=O)ccn(CCCCCOc2ccccc2)c1=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H29N3O5/c33-27(30-23-14-16-26(17-15-23)37-25-12-6-2-7-13-25)22-32-28(34)18-20-31(29(32)35)19-8-3-9-21-36-24-10-4-1-5-11-24/h1-2,4-7,10-18,20H,3,8-9,19,21-22H2,(H,30,33) |
| InChIKey | XCIJQVZLERDVOV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|