C15H10F2N2O — CID 62403831
2-(4-cyanophenyl)-N-(2,6-difluorophenyl)acetamide (PubChem CID 62403831) has the molecular formula C15H10F2N2O and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(4-cyanophenyl)-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 62403831 |
| Molecular Formula | C15H10F2N2O |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(4-cyanophenyl)-N-(2,6-difluorophenyl)acetamide |
| SMILES | N#Cc1ccc(CC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C15H10F2N2O/c16-12-2-1-3-13(17)15(12)19-14(20)8-10-4-6-11(9-18)7-5-10/h1-7H,8H2,(H,19,20) |
| InChIKey | HWYJFVAJGUGCIZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |