C20H29ClN4O3S — CID 67348570
2-(2-cycloheptylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-nitrophenyl)acetamide;hydrochloride (PubChem CID 67348570) has the molecular formula C20H29ClN4O3S and a molecular weight of 441.00 g/mol. Its IUPAC name is 2-(2-cycloheptylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-(2-cycloheptylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67348570 |
| Molecular Formula | C20H29ClN4O3S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-(2-cycloheptylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-nitrophenyl)acetamide;hydrochloride |
| SMILES | CC1S/C(=N\C2CCCCCC2)N(C)C1CC(=O)Nc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C20H28N4O3S.ClH/c1-14-18(13-19(25)21-16-9-11-17(12-10-16)24(26)27)23(2)20(28-14)22-15-7-5-3-4-6-8-15;/h9-12,14-15,18H,3-8,13H2,1-2H3,(H,21,25);1H/b22-20-; |
| InChIKey | LIDWNVKABFQTOH-KGYDJYTLSA-N |
| XLogP | 4.86 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|