C19H26FN3OS — CID 67351269
N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(3-fluorophenyl)acetamide (PubChem CID 67351269) has the molecular formula C19H26FN3OS and a molecular weight of 363.50 g/mol. Its IUPAC name is N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(3-fluorophenyl)acetamide.
| Compound Name | N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67351269 |
| Molecular Formula | C19H26FN3OS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(3-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1cccc(F)c1)C1C(C)S/C(=N\C2CCCCC2)N1C |
| InChI | InChI=1S/C19H26FN3OS/c1-13-18(23(14(2)24)17-11-7-8-15(20)12-17)22(3)19(25-13)21-16-9-5-4-6-10-16/h7-8,11-13,16,18H,4-6,9-10H2,1-3H3/b21-19- |
| InChIKey | LVKHVAVJWHIZAD-VZCXRCSSSA-N |
| XLogP | 4.26 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|