C19H26FN3OS — CID 140532184
2-cycloheptylimino-N-[(3-fluorophenyl)methyl]-3-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 140532184) has the molecular formula C19H26FN3OS and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-cycloheptylimino-N-[(3-fluorophenyl)methyl]-3-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-cycloheptylimino-N-[(3-fluorophenyl)methyl]-3-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 140532184 |
| Molecular Formula | C19H26FN3OS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-cycloheptylimino-N-[(3-fluorophenyl)methyl]-3-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C19H26FN3OS/c1-23-17(18(24)21-12-14-7-6-8-15(20)11-14)13-25-19(23)22-16-9-4-2-3-5-10-16/h6-8,11,16-17H,2-5,9-10,12-13H2,1H3,(H,21,24)/b22-19- |
| InChIKey | LBVCVAHTHYVDKJ-QOCHGBHMSA-N |
| XLogP | 3.57 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|