C19H27Cl2N3OS — CID 140532179
N-[(4-chlorophenyl)methyl]-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 140532179) has the molecular formula C19H27Cl2N3OS and a molecular weight of 416.42 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 140532179 |
| Molecular Formula | C19H27Cl2N3OS |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1C(=O)NCc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C19H26ClN3OS.ClH/c1-23-17(18(24)21-12-14-8-10-15(20)11-9-14)13-25-19(23)22-16-6-4-2-3-5-7-16;/h8-11,16-17H,2-7,12-13H2,1H3,(H,21,24);1H/b22-19-; |
| InChIKey | ZPGWRLYRKZFSRX-GXTSIBQPSA-N |
| XLogP | 4.50 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|