C18H23Cl2N3OS — CID 25122055
N-[(4-chlorophenyl)methyl]-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride (PubChem CID 25122055) has the molecular formula C18H23Cl2N3OS and a molecular weight of 400.38 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 25122055 |
| Molecular Formula | C18H23Cl2N3OS |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride |
| SMILES | Cl.Cn1c(CC(=O)NCc2ccc(Cl)cc2)cs/c1=N\C1CCCC1 |
| InChI | InChI=1S/C18H22ClN3OS.ClH/c1-22-16(12-24-18(22)21-15-4-2-3-5-15)10-17(23)20-11-13-6-8-14(19)9-7-13;/h6-9,12,15H,2-5,10-11H2,1H3,(H,20,23);1H/b21-18-; |
| InChIKey | OKRWAOXIAHVBJB-WIPIHYDQSA-N |
| XLogP | 3.86 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|