C20H27Cl2N3OS — CID 25122057
N-[(4-chlorophenyl)methyl]-2-(2-cycloheptylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride (PubChem CID 25122057) has the molecular formula C20H27Cl2N3OS and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(2-cycloheptylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(2-cycloheptylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 25122057 |
| Molecular Formula | C20H27Cl2N3OS |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(2-cycloheptylimino-3-methyl-1,3-thiazol-4-yl)acetamide;hydrochloride |
| SMILES | Cl.Cn1c(CC(=O)NCc2ccc(Cl)cc2)cs/c1=N\C1CCCCCC1 |
| InChI | InChI=1S/C20H26ClN3OS.ClH/c1-24-18(12-19(25)22-13-15-8-10-16(21)11-9-15)14-26-20(24)23-17-6-4-2-3-5-7-17;/h8-11,14,17H,2-7,12-13H2,1H3,(H,22,25);1H/b23-20-; |
| InChIKey | GXFDXRNAVRZKOU-QTXBERLJSA-N |
| XLogP | 4.64 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|