C18H22ClF2N3OS — CID 25119605
2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)-N-(2,4-difluorophenyl)acetamide;hydrochloride (PubChem CID 25119605) has the molecular formula C18H22ClF2N3OS and a molecular weight of 401.91 g/mol. Its IUPAC name is 2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)-N-(2,4-difluorophenyl)acetamide;hydrochloride.
| Compound Name | 2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)-N-(2,4-difluorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 25119605 |
| Molecular Formula | C18H22ClF2N3OS |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)-N-(2,4-difluorophenyl)acetamide;hydrochloride |
| SMILES | Cl.Cn1c(CC(=O)Nc2ccc(F)cc2F)cs/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C18H21F2N3OS.ClH/c1-23-14(11-25-18(23)21-13-5-3-2-4-6-13)10-17(24)22-16-8-7-12(19)9-15(16)20;/h7-9,11,13H,2-6,10H2,1H3,(H,22,24);1H/b21-18-; |
| InChIKey | KMGKRHKLKUGFKX-WIPIHYDQSA-N |
| XLogP | 4.20 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|