C17H19ClFN3OS — CID 25120309
N-(4-chloro-2-fluorophenyl)-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 25120309) has the molecular formula C17H19ClFN3OS and a molecular weight of 367.88 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 25120309 |
| Molecular Formula | C17H19ClFN3OS |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(2-cyclopentylimino-3-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cn1c(CC(=O)Nc2ccc(Cl)cc2F)cs/c1=N\C1CCCC1 |
| InChI | InChI=1S/C17H19ClFN3OS/c1-22-13(10-24-17(22)20-12-4-2-3-5-12)9-16(23)21-15-7-6-11(18)8-14(15)19/h6-8,10,12H,2-5,9H2,1H3,(H,21,23)/b20-17- |
| InChIKey | GGFZNGMWHCWTEV-JZJYNLBNSA-N |
| XLogP | 3.90 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|