C19H28ClN3OS — CID 67348536
N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide;hydrochloride (PubChem CID 67348536) has the molecular formula C19H28ClN3OS and a molecular weight of 381.97 g/mol. Its IUPAC name is N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide;hydrochloride.
| Compound Name | N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67348536 |
| Molecular Formula | C19H28ClN3OS |
| Molecular Weight | 381.97 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide;hydrochloride |
| SMILES | CC(=O)N(c1ccc(C)cc1)C1CS/C(=N\C2CCCCC2)N1C.Cl |
| InChI | InChI=1S/C19H27N3OS.ClH/c1-14-9-11-17(12-10-14)22(15(2)23)18-13-24-19(21(18)3)20-16-7-5-4-6-8-16;/h9-12,16,18H,4-8,13H2,1-3H3;1H/b20-19-; |
| InChIKey | DFWZGZPLBJJBHI-BLTQDSCZSA-N |
| XLogP | 4.46 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.97 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|