C16H20FN3OS — CID 67346525
N-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide (PubChem CID 67346525) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide.
| Compound Name | N-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 67346525 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(2-fluoro-4-methylphenyl)acetamide |
| SMILES | CC(=O)N(c1ccc(C)cc1F)C1CS/C(=N\C2CC2)N1C |
| InChI | InChI=1S/C16H20FN3OS/c1-10-4-7-14(13(17)8-10)20(11(2)21)15-9-22-16(19(15)3)18-12-5-6-12/h4,7-8,12,15H,5-6,9H2,1-3H3/b18-16- |
| InChIKey | YFFUOFNCEYUCIR-VLGSPTGOSA-N |
| XLogP | 3.01 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|