C18H23ClFN3OS — CID 140532173
N-(5-chloro-2-fluorophenyl)-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 140532173) has the molecular formula C18H23ClFN3OS and a molecular weight of 383.92 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 140532173 |
| Molecular Formula | C18H23ClFN3OS |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-cycloheptylimino-3-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1C(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C18H23ClFN3OS/c1-23-16(17(24)22-15-10-12(19)8-9-14(15)20)11-25-18(23)21-13-6-4-2-3-5-7-13/h8-10,13,16H,2-7,11H2,1H3,(H,22,24)/b21-18- |
| InChIKey | ZXPMGCRCFAYNBM-UZYVYHOESA-N |
| XLogP | 4.54 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|