C22H34BrN3OS — CID 87365361
N-(4-butylphenyl)-N-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)formamide;hydrobromide (PubChem CID 87365361) has the molecular formula C22H34BrN3OS and a molecular weight of 468.51 g/mol. Its IUPAC name is N-(4-butylphenyl)-N-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)formamide;hydrobromide.
| Compound Name | N-(4-butylphenyl)-N-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)formamide;hydrobromide |
|---|---|
| PubChem CID | 87365361 |
| Molecular Formula | C22H34BrN3OS |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-(4-butylphenyl)-N-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)formamide;hydrobromide |
| SMILES | Br.CCCCc1ccc(N(C=O)C2CS/C(=N\C3CCCCCC3)N2C)cc1 |
| InChI | InChI=1S/C22H33N3OS.BrH/c1-3-4-9-18-12-14-20(15-13-18)25(17-26)21-16-27-22(24(21)2)23-19-10-7-5-6-8-11-19;/h12-15,17,19,21H,3-11,16H2,1-2H3;1H/b23-22-; |
| InChIKey | IDPJLMCQVUCGFH-YJACDMIVSA-N |
| XLogP | 5.65 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|