C24H29BrClN3OS — CID 67349071
N-(3-benzyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-bromophenyl)acetamide;hydrochloride (PubChem CID 67349071) has the molecular formula C24H29BrClN3OS and a molecular weight of 522.94 g/mol. Its IUPAC name is N-(3-benzyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-bromophenyl)acetamide;hydrochloride.
| Compound Name | N-(3-benzyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-bromophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67349071 |
| Molecular Formula | C24H29BrClN3OS |
| Molecular Weight | 522.94 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | N-(3-benzyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-bromophenyl)acetamide;hydrochloride |
| SMILES | CC(=O)N(c1ccc(Br)cc1)C1CS/C(=N\C2CCCCC2)N1Cc1ccccc1.Cl |
| InChI | InChI=1S/C24H28BrN3OS.ClH/c1-18(29)28(22-14-12-20(25)13-15-22)23-17-30-24(26-21-10-6-3-7-11-21)27(23)16-19-8-4-2-5-9-19;/h2,4-5,8-9,12-15,21,23H,3,6-7,10-11,16-17H2,1H3;1H/b26-24-; |
| InChIKey | JULSPRLBBIRNOE-FSKGQQLBSA-N |
| XLogP | 6.49 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.94 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|