C18H20N2O4S — CID 17412915
1-methylsulfonyl-N-(4-phenoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 17412915) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(4-phenoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(4-phenoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 17412915 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-methylsulfonyl-N-(4-phenoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-25(22,23)20-13-5-8-17(20)18(21)19-14-9-11-16(12-10-14)24-15-6-3-2-4-7-15/h2-4,6-7,9-12,17H,5,8,13H2,1H3,(H,19,21) |
| InChIKey | HVJSGSFSEAIJCT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |