C14H18N2O5S — CID 39994808
(4-acetamidophenyl) (2R)-1-methylsulfonylpyrrolidine-2-carboxylate (PubChem CID 39994808) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is (4-acetamidophenyl) (2R)-1-methylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | (4-acetamidophenyl) (2R)-1-methylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 39994808 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (4-acetamidophenyl) (2R)-1-methylsulfonylpyrrolidine-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)[C@H]2CCCN2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H18N2O5S/c1-10(17)15-11-5-7-12(8-6-11)21-14(18)13-4-3-9-16(13)22(2,19)20/h5-8,13H,3-4,9H2,1-2H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | WQWUCUCFNWPHND-CYBMUJFWSA-N |
| XLogP | 0.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|