C12H17N3O4S — CID 39898332
(2R)-N-(6-methoxy-3-pyridinyl)-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 39898332) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (2R)-N-(6-methoxy-3-pyridinyl)-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(6-methoxy-3-pyridinyl)-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 39898332 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2R)-N-(6-methoxy-3-pyridinyl)-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CCCN2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C12H17N3O4S/c1-19-11-6-5-9(8-13-11)14-12(16)10-4-3-7-15(10)20(2,17)18/h5-6,8,10H,3-4,7H2,1-2H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | CIFKHSMRKPNDKM-SNVBAGLBSA-N |
| XLogP | 0.45 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |