C15H21N3O4 — CID 162353607
tert-butyl 2-[(6-methoxy-3-pyridinyl)carbamoyl]azetidine-1-carboxylate (PubChem CID 162353607) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is tert-butyl 2-[(6-methoxy-3-pyridinyl)carbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(6-methoxy-3-pyridinyl)carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162353607 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl 2-[(6-methoxy-3-pyridinyl)carbamoyl]azetidine-1-carboxylate |
| SMILES | COc1ccc(NC(=O)C2CCN2C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C15H21N3O4/c1-15(2,3)22-14(20)18-8-7-11(18)13(19)17-10-5-6-12(21-4)16-9-10/h5-6,9,11H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | CBIOWRPFRBWGBR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |