C22H25N5O3 — CID 55938947
tert-butyl (2S)-2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 55938947) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 55938947 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl (2S)-2-[[6-(benzimidazol-1-yl)-3-pyridinyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)Nc1ccc(-n2cnc3ccccc32)nc1 |
| InChI | InChI=1S/C22H25N5O3/c1-22(2,3)30-21(29)26-12-6-9-18(26)20(28)25-15-10-11-19(23-13-15)27-14-24-16-7-4-5-8-17(16)27/h4-5,7-8,10-11,13-14,18H,6,9,12H2,1-3H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | ZQPJGCVVJQCTAE-SFHVURJKSA-N |
| XLogP | 3.76 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |