C19H16N3O5S- — CID 7499751
2-[(2Z,5S)-3-(4-hydroxyphenyl)-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 7499751) has the molecular formula C19H16N3O5S- and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(2Z,5S)-3-(4-hydroxyphenyl)-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5S)-3-(4-hydroxyphenyl)-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 7499751 |
| Molecular Formula | C19H16N3O5S- |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[(2Z,5S)-3-(4-hydroxyphenyl)-2-[(Z)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | COc1ccc(/C=N\N=C2/S[C@@H](CC(=O)[O-])C(=O)N2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O5S/c1-27-15-8-2-12(3-9-15)11-20-21-19-22(13-4-6-14(23)7-5-13)18(26)16(28-19)10-17(24)25/h2-9,11,16,23H,10H2,1H3,(H,24,25)/p-1/b20-11-,21-19-/t16-/m0/s1 |
| InChIKey | TUXQJGHLHDZSOD-MCYOPLRSSA-M |
| XLogP | 1.38 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|