C21H20N4O7S — CID 135851287
2-[[2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid (PubChem CID 135851287) has the molecular formula C21H20N4O7S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-[[2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 135851287 |
| Molecular Formula | C21H20N4O7S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[[2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid |
| SMILES | COc1cc(/C=N/N=C2SC(CC(=O)NCC(=O)O)C(=O)N2c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C21H20N4O7S/c1-32-16-8-12(2-7-15(16)27)10-23-24-21-25(13-3-5-14(26)6-4-13)20(31)17(33-21)9-18(28)22-11-19(29)30/h2-8,10,17,26-27H,9,11H2,1H3,(H,22,28)(H,29,30)/b23-10+,24-21? |
| InChIKey | FLSGWYZPTDJCJO-MFVHQVPJSA-N |
| XLogP | 1.54 |
| TPSA | 161.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|