C25H21ClN4O5S — CID 135685650
N-(4-chlorophenyl)-2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(3-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135685650) has the molecular formula C25H21ClN4O5S and a molecular weight of 524.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(3-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(3-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135685650 |
| Molecular Formula | C25H21ClN4O5S |
| Molecular Weight | 524.99 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[(E)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(3-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1cc(/C=N/N=C2SC(CC(=O)Nc3ccc(Cl)cc3)C(=O)N2c2cccc(O)c2)ccc1O |
| InChI | InChI=1S/C25H21ClN4O5S/c1-35-21-11-15(5-10-20(21)32)14-27-29-25-30(18-3-2-4-19(31)12-18)24(34)22(36-25)13-23(33)28-17-8-6-16(26)7-9-17/h2-12,14,22,31-32H,13H2,1H3,(H,28,33)/b27-14+,29-25? |
| InChIKey | ALNWZHRDRKYVMG-NVVGGFRBSA-N |
| XLogP | 4.63 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|