C19H17N3O6S — CID 136911111
2-[(2E,5R)-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 136911111) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-[(2E,5R)-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E,5R)-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136911111 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-[(2E,5R)-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(/C=N\N=C2\S[C@H](CC(=O)O)C(=O)N2c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C19H17N3O6S/c1-28-15-8-11(2-7-14(15)24)10-20-21-19-22(12-3-5-13(23)6-4-12)18(27)16(29-19)9-17(25)26/h2-8,10,16,23-24H,9H2,1H3,(H,25,26)/b20-10-,21-19+/t16-/m1/s1 |
| InChIKey | JTEXOMRXEJFSAL-IOIKYLARSA-N |
| XLogP | 2.42 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|