C13H13NO4S — CID 51859647
2-[(5S)-3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 51859647) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[(5S)-3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5S)-3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 51859647 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-[(5S)-3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1cccc(N2C(=O)S[C@@H](CC(=O)O)C2=O)c1C |
| InChI | InChI=1S/C13H13NO4S/c1-7-4-3-5-9(8(7)2)14-12(17)10(6-11(15)16)19-13(14)18/h3-5,10H,6H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | DKDBGYGCFZCRAL-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|