C14H14N2O4S2 — CID 18892114
2-[[2-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid (PubChem CID 18892114) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[[2-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 18892114 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[[2-[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]acetic acid |
| SMILES | Cc1ccccc1N1C(=O)C(CC(=O)NCC(=O)O)SC1=S |
| InChI | InChI=1S/C14H14N2O4S2/c1-8-4-2-3-5-9(8)16-13(20)10(22-14(16)21)6-11(17)15-7-12(18)19/h2-5,10H,6-7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | MINDGHPUBTYEAM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|