C17H20N2O3S2 — CID 18892057
N-(2-methylphenyl)-2-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide (PubChem CID 18892057) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 18892057 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(2-methylphenyl)-2-[4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccccc1NC(=O)CC1SC(=S)N(CC2CCCO2)C1=O |
| InChI | InChI=1S/C17H20N2O3S2/c1-11-5-2-3-7-13(11)18-15(20)9-14-16(21)19(17(23)24-14)10-12-6-4-8-22-12/h2-3,5,7,12,14H,4,6,8-10H2,1H3,(H,18,20) |
| InChIKey | KKLAQKWVOJDLNZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|