C21H20N2O7S — CID 43864045
2-[4-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl]acetic acid (PubChem CID 43864045) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[4-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 43864045 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-[4-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]phenyl]acetic acid |
| SMILES | COc1ccc(N2C(=O)SC(CC(=O)Nc3ccc(CC(=O)O)cc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C21H20N2O7S/c1-29-14-7-8-15(16(10-14)30-2)23-20(27)17(31-21(23)28)11-18(24)22-13-5-3-12(4-6-13)9-19(25)26/h3-8,10,17H,9,11H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | DSJIRFUVWNSXAV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_D(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|