C14H15NO6S — CID 43827010
2-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid (PubChem CID 43827010) has the molecular formula C14H15NO6S and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 43827010 |
| Molecular Formula | C14H15NO6S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetic acid |
| SMILES | COc1ccc(N2C(=O)CC(SCC(=O)O)C2=O)c(OC)c1 |
| InChI | InChI=1S/C14H15NO6S/c1-20-8-3-4-9(10(5-8)21-2)15-12(16)6-11(14(15)19)22-7-13(17)18/h3-5,11H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | CIAKWORJYUBKIC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|