C25H19F4N3O2S — CID 3420603
2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 3420603) has the molecular formula C25H19F4N3O2S and a molecular weight of 501.51 g/mol. Its IUPAC name is 2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3420603 |
| Molecular Formula | C25H19F4N3O2S |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CC1C(=O)N(c2cccc(C(F)(F)F)c2)C(=S)N1Cc1ccccc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H19F4N3O2S/c26-18-9-11-19(12-10-18)30-22(33)14-21-23(34)32(20-8-4-7-17(13-20)25(27,28)29)24(35)31(21)15-16-5-2-1-3-6-16/h1-13,21H,14-15H2,(H,30,33) |
| InChIKey | WUSFSNLQPZXKMI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|