C27H24F3N3O3S — CID 3400041
2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 3400041) has the molecular formula C27H24F3N3O3S and a molecular weight of 527.57 g/mol. Its IUPAC name is 2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3400041 |
| Molecular Formula | C27H24F3N3O3S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 2-[3-benzyl-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CC2C(=O)N(c3cccc(C(F)(F)F)c3)C(=S)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H24F3N3O3S/c1-2-36-22-13-11-20(12-14-22)31-24(34)16-23-25(35)33(21-10-6-9-19(15-21)27(28,29)30)26(37)32(23)17-18-7-4-3-5-8-18/h3-15,23H,2,16-17H2,1H3,(H,31,34) |
| InChIKey | SIANFMYREPNRIC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|