C26H19F3IN3O4S — CID 4091574
2-[3-(1,3-benzodioxol-5-ylmethyl)-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-iodophenyl)acetamide (PubChem CID 4091574) has the molecular formula C26H19F3IN3O4S and a molecular weight of 653.42 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-ylmethyl)-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 4091574 |
| Molecular Formula | C26H19F3IN3O4S |
| Molecular Weight | 653.42 g/mol |
| Exact Mass | 653.01 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-5-oxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CC1C(=O)N(c2cccc(C(F)(F)F)c2)C(=S)N1Cc1ccc2c(c1)OCO2)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C26H19F3IN3O4S/c27-26(28,29)16-2-1-3-19(11-16)33-24(35)20(12-23(34)31-18-7-5-17(30)6-8-18)32(25(33)38)13-15-4-9-21-22(10-15)37-14-36-21/h1-11,20H,12-14H2,(H,31,34) |
| InChIKey | KGYOPGZRCLTWEL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|