C29H21F3N4O6S3 — CID 43846422
N-(4-sulfamoylphenyl)-2-[(8R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 43846422) has the molecular formula C29H21F3N4O6S3 and a molecular weight of 674.70 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[(8R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[(8R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 43846422 |
| Molecular Formula | C29H21F3N4O6S3 |
| Molecular Weight | 674.70 g/mol |
| Exact Mass | 674.06 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[(8R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2)C2C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C29H21F3N4O6S3/c30-29(31,32)16-7-4-8-18(13-16)36-25(38)22-21(15-5-2-1-3-6-15)24-27(43-23(22)26(36)39)35(28(40)44-24)14-20(37)34-17-9-11-19(12-10-17)45(33,41)42/h1-13,21-23H,14H2,(H,34,37)(H2,33,41,42)/t21-,22?,23?/m0/s1 |
| InChIKey | YAIAKFMHVDHHMX-UVKLAMSESA-N |
| XLogP | 4.01 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|