C32H30N4O6S3 — CID 16635797
2-[(8S)-8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16635797) has the molecular formula C32H30N4O6S3 and a molecular weight of 662.82 g/mol. Its IUPAC name is 2-[(8S)-8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8S)-8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16635797 |
| Molecular Formula | C32H30N4O6S3 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.13 |
| IUPAC Name | 2-[(8S)-8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C32H30N4O6S3/c1-32(2,3)19-11-9-18(10-12-19)24-25-26(29(39)36(28(25)38)21-7-5-4-6-8-21)43-30-27(24)44-31(40)35(30)17-23(37)34-20-13-15-22(16-14-20)45(33,41)42/h4-16,24-26H,17H2,1-3H3,(H,34,37)(H2,33,41,42)/t24-,25?,26?/m1/s1 |
| InChIKey | HMJYRKSBXGUTQI-JDSVYEKJSA-N |
| XLogP | 4.29 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|