C32H28ClN3O4S2 — CID 43848160
2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 43848160) has the molecular formula C32H28ClN3O4S2 and a molecular weight of 618.18 g/mol. Its IUPAC name is 2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 43848160 |
| Molecular Formula | C32H28ClN3O4S2 |
| Molecular Weight | 618.18 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | 2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(Cl)cc4)c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C32H28ClN3O4S2/c1-32(2,3)19-11-9-18(10-12-19)24-25-26(29(39)36(28(25)38)22-7-5-4-6-8-22)41-30-27(24)42-31(40)35(30)17-23(37)34-21-15-13-20(33)14-16-21/h4-16,24-26H,17H2,1-3H3,(H,34,37) |
| InChIKey | NEDSRQGSUINRRX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.18 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|