C28H18Cl3N3O4S2 — CID 43846010
2-[(8R)-8,11-bis(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 43846010) has the molecular formula C28H18Cl3N3O4S2 and a molecular weight of 630.96 g/mol. Its IUPAC name is 2-[(8R)-8,11-bis(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(8R)-8,11-bis(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 43846010 |
| Molecular Formula | C28H18Cl3N3O4S2 |
| Molecular Weight | 630.96 g/mol |
| Exact Mass | 628.98 |
| IUPAC Name | 2-[(8R)-8,11-bis(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccc(Cl)cc1)C1C(=O)N(c3ccc(Cl)cc3)C(=O)C1S2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H18Cl3N3O4S2/c29-15-3-1-14(2-4-15)21-22-23(26(37)34(25(22)36)19-11-7-17(31)8-12-19)39-27-24(21)40-28(38)33(27)13-20(35)32-18-9-5-16(30)6-10-18/h1-12,21-23H,13H2,(H,32,35)/t21-,22?,23?/m0/s1 |
| InChIKey | IPJCVOFAMUKBND-UVKLAMSESA-N |
| XLogP | 6.30 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.96 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|