C28H19Cl2N3O4S2 — CID 19247763
N-(4-chlorophenyl)-2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19247763) has the molecular formula C28H19Cl2N3O4S2 and a molecular weight of 596.52 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19247763 |
| Molecular Formula | C28H19Cl2N3O4S2 |
| Molecular Weight | 596.52 g/mol |
| Exact Mass | 595.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]1S2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H19Cl2N3O4S2/c29-16-6-10-18(11-7-16)31-20(34)14-32-27-24(39-28(32)37)21(15-4-2-1-3-5-15)22-23(38-27)26(36)33(25(22)35)19-12-8-17(30)9-13-19/h1-13,21-23H,14H2,(H,31,34)/t21-,22-,23+/m0/s1 |
| InChIKey | MOHZEMGDAVPONY-RJGXRXQPSA-N |
| XLogP | 5.65 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|