C32H22ClN3O4S2 — CID 19247988
2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 19247988) has the molecular formula C32H22ClN3O4S2 and a molecular weight of 612.13 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 19247988 |
| Molecular Formula | C32H22ClN3O4S2 |
| Molecular Weight | 612.13 g/mol |
| Exact Mass | 611.07 |
| IUPAC Name | 2-[(1R,8R,9R)-11-(4-chlorophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]1S2)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H22ClN3O4S2/c33-21-11-14-23(15-12-21)36-29(38)26-25(19-7-2-1-3-8-19)28-31(41-27(26)30(36)39)35(32(40)42-28)17-24(37)34-22-13-10-18-6-4-5-9-20(18)16-22/h1-16,25-27H,17H2,(H,34,37)/t25-,26-,27+/m0/s1 |
| InChIKey | FZFSUAKJGRWBLL-GMQQYTKMSA-N |
| XLogP | 6.15 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.13 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|