C32H22BrN3O4S2 — CID 16635955
2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 16635955) has the molecular formula C32H22BrN3O4S2 and a molecular weight of 656.58 g/mol. Its IUPAC name is 2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16635955 |
| Molecular Formula | C32H22BrN3O4S2 |
| Molecular Weight | 656.58 g/mol |
| Exact Mass | 655.02 |
| IUPAC Name | 2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccc(Br)c1)C1C(=O)N(c3ccccc3)C(=O)C1S2)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H22BrN3O4S2/c33-21-10-6-9-20(15-21)25-26-27(30(39)36(29(26)38)23-11-2-1-3-12-23)41-31-28(25)42-32(40)35(31)17-24(37)34-22-14-13-18-7-4-5-8-19(18)16-22/h1-16,25-27H,17H2,(H,34,37)/t25-,26?,27?/m1/s1 |
| InChIKey | AMSMFFILVSKLKR-FKDZAPPDSA-N |
| XLogP | 6.26 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|