C29H22BrN3O4S2 — CID 19249304
2-[(1R,8R,9R)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 19249304) has the molecular formula C29H22BrN3O4S2 and a molecular weight of 620.55 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19249304 |
| Molecular Formula | C29H22BrN3O4S2 |
| Molecular Weight | 620.55 g/mol |
| Exact Mass | 619.02 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(3-bromophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cn1c2c(sc1=O)[C@@H](c1cccc(Br)c1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C29H22BrN3O4S2/c1-16-8-5-6-13-20(16)31-21(34)15-32-28-25(39-29(32)37)22(17-9-7-10-18(30)14-17)23-24(38-28)27(36)33(26(23)35)19-11-3-2-4-12-19/h2-14,22-24H,15H2,1H3,(H,31,34)/t22-,23-,24+/m0/s1 |
| InChIKey | LLNXZEWQNLUNKG-KMDXXIMOSA-N |
| XLogP | 5.42 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|