C34H26BrN3O6S2 — CID 16634775
2-[(8S)-11-(4-bromophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 16634775) has the molecular formula C34H26BrN3O6S2 and a molecular weight of 716.64 g/mol. Its IUPAC name is 2-[(8S)-11-(4-bromophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(8S)-11-(4-bromophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16634775 |
| Molecular Formula | C34H26BrN3O6S2 |
| Molecular Weight | 716.64 g/mol |
| Exact Mass | 715.04 |
| IUPAC Name | 2-[(8S)-11-(4-bromophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | COc1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4ccc5ccccc5c4)c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)cc1OC |
| InChI | InChI=1S/C34H26BrN3O6S2/c1-43-24-14-8-20(16-25(24)44-2)27-28-29(32(41)38(31(28)40)23-12-9-21(35)10-13-23)45-33-30(27)46-34(42)37(33)17-26(39)36-22-11-7-18-5-3-4-6-19(18)15-22/h3-16,27-29H,17H2,1-2H3,(H,36,39)/t27-,28?,29?/m1/s1 |
| InChIKey | VTPSAZZHLVHFGC-JMYZALGVSA-N |
| XLogP | 6.28 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|