C35H29N3O7S2 — CID 19249054
2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide (PubChem CID 19249054) has the molecular formula C35H29N3O7S2 and a molecular weight of 667.77 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 19249054 |
| Molecular Formula | C35H29N3O7S2 |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.14 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](c4ccc(OC)c(OC)c4)c4sc(=O)n(CC(=O)Nc5cccc6ccccc56)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C35H29N3O7S2/c1-43-22-14-12-21(13-15-22)38-32(40)29-28(20-11-16-25(44-2)26(17-20)45-3)31-34(46-30(29)33(38)41)37(35(42)47-31)18-27(39)36-24-10-6-8-19-7-4-5-9-23(19)24/h4-17,28-30H,18H2,1-3H3,(H,36,39)/t28-,29-,30+/m0/s1 |
| InChIKey | OPMOZWWQRIULLP-OIFRRMEBSA-N |
| XLogP | 5.52 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|